C21H25ClO4S — CID 10070062
ethyl 3-chloro-4-[7-(5-methylthiophen-2-yl)-7-oxoheptoxy]benzoate (PubChem CID 10070062) has the molecular formula C21H25ClO4S and a molecular weight of 408.95 g/mol. Its IUPAC name is ethyl 3-chloro-4-[7-(5-methylthiophen-2-yl)-7-oxoheptoxy]benzoate.
| Compound Name | ethyl 3-chloro-4-[7-(5-methylthiophen-2-yl)-7-oxoheptoxy]benzoate |
|---|---|
| PubChem CID | 10070062 |
| Molecular Formula | C21H25ClO4S |
| Molecular Weight | 408.95 g/mol |
| Exact Mass | 408.12 |
| IUPAC Name | ethyl 3-chloro-4-[7-(5-methylthiophen-2-yl)-7-oxoheptoxy]benzoate |
| SMILES | CCOC(=O)c1ccc(OCCCCCCC(=O)c2ccc(C)s2)c(Cl)c1 |
| InChI | InChI=1S/C21H25ClO4S/c1-3-25-21(24)16-10-11-19(17(22)14-16)26-13-7-5-4-6-8-18(23)20-12-9-15(2)27-20/h9-12,14H,3-8,13H2,1-2H3 |
| InChIKey | ODUBYWANSRCBKA-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.95 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|