C16H20N2O4 — CID 25018606
7-(4-hydroxyphenoxy)-1-(5-methyl-1,3,4-oxadiazol-2-yl)heptan-1-one (PubChem CID 25018606) has the molecular formula C16H20N2O4 and a molecular weight of 304.35 g/mol. Its IUPAC name is 7-(4-hydroxyphenoxy)-1-(5-methyl-1,3,4-oxadiazol-2-yl)heptan-1-one.
| Compound Name | 7-(4-hydroxyphenoxy)-1-(5-methyl-1,3,4-oxadiazol-2-yl)heptan-1-one |
|---|---|
| PubChem CID | 25018606 |
| Molecular Formula | C16H20N2O4 |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.14 |
| IUPAC Name | 7-(4-hydroxyphenoxy)-1-(5-methyl-1,3,4-oxadiazol-2-yl)heptan-1-one |
| SMILES | Cc1nnc(C(=O)CCCCCCOc2ccc(O)cc2)o1 |
| InChI | InChI=1S/C16H20N2O4/c1-12-17-18-16(22-12)15(20)6-4-2-3-5-11-21-14-9-7-13(19)8-10-14/h7-10,19H,2-6,11H2,1H3 |
| InChIKey | UHFAOSFWBFSXEX-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 85.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|