C29H30N2O5 — CID 42639085
1-[5-(phenylmethoxymethyl)-1,3,4-oxadiazol-2-yl]-6-(4-phenylmethoxyphenoxy)hexan-1-one (PubChem CID 42639085) has the molecular formula C29H30N2O5 and a molecular weight of 486.57 g/mol. Its IUPAC name is 1-[5-(phenylmethoxymethyl)-1,3,4-oxadiazol-2-yl]-6-(4-phenylmethoxyphenoxy)hexan-1-one.
| Compound Name | 1-[5-(phenylmethoxymethyl)-1,3,4-oxadiazol-2-yl]-6-(4-phenylmethoxyphenoxy)hexan-1-one |
|---|---|
| PubChem CID | 42639085 |
| Molecular Formula | C29H30N2O5 |
| Molecular Weight | 486.57 g/mol |
| Exact Mass | 486.22 |
| IUPAC Name | 1-[5-(phenylmethoxymethyl)-1,3,4-oxadiazol-2-yl]-6-(4-phenylmethoxyphenoxy)hexan-1-one |
| SMILES | O=C(CCCCCOc1ccc(OCc2ccccc2)cc1)c1nnc(COCc2ccccc2)o1 |
| InChI | InChI=1S/C29H30N2O5/c32-27(29-31-30-28(36-29)22-33-20-23-10-4-1-5-11-23)14-8-3-9-19-34-25-15-17-26(18-16-25)35-21-24-12-6-2-7-13-24/h1-2,4-7,10-13,15-18H,3,8-9,14,19-22H2 |
| InChIKey | ITSWZKABRQPQGL-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 83.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.57 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|