C7H11N3O3 — CID 30122873
2-[(2R)-3-amino-2-hydroxypropyl]-1H-pyridazine-3,6-dione (PubChem CID 30122873) has the molecular formula C7H11N3O3 and a molecular weight of 185.18 g/mol. Its IUPAC name is 2-[(2R)-3-amino-2-hydroxypropyl]-1H-pyridazine-3,6-dione.
| Compound Name | 2-[(2R)-3-amino-2-hydroxypropyl]-1H-pyridazine-3,6-dione |
|---|---|
| PubChem CID | 30122873 |
| Molecular Formula | C7H11N3O3 |
| Molecular Weight | 185.18 g/mol |
| Exact Mass | 185.08 |
| IUPAC Name | 2-[(2R)-3-amino-2-hydroxypropyl]-1H-pyridazine-3,6-dione |
| SMILES | NC[C@@H](O)Cn1[nH]c(=O)ccc1=O |
| InChI | InChI=1S/C7H11N3O3/c8-3-5(11)4-10-7(13)2-1-6(12)9-10/h1-2,5,11H,3-4,8H2,(H,9,12)/t5-/m1/s1 |
| InChIKey | SXEPLJILOKLABB-RXMQYKEDSA-N |
| XLogP | -2.14 |
| TPSA | 101.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.18 |
| LogP ≤ 5 | -2.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |