C21H26ClN3O5S — CID 30127373
N'-(5-chloro-2-methoxyphenyl)-N-[2-[4-(diethylsulfamoyl)phenyl]ethyl]oxamide (PubChem CID 30127373) has the molecular formula C21H26ClN3O5S and a molecular weight of 467.98 g/mol. Its IUPAC name is N'-(5-chloro-2-methoxyphenyl)-N-[2-[4-(diethylsulfamoyl)phenyl]ethyl]oxamide.
| Compound Name | N'-(5-chloro-2-methoxyphenyl)-N-[2-[4-(diethylsulfamoyl)phenyl]ethyl]oxamide |
|---|---|
| PubChem CID | 30127373 |
| Molecular Formula | C21H26ClN3O5S |
| Molecular Weight | 467.98 g/mol |
| Exact Mass | 467.13 |
| IUPAC Name | N'-(5-chloro-2-methoxyphenyl)-N-[2-[4-(diethylsulfamoyl)phenyl]ethyl]oxamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(CCNC(=O)C(=O)Nc2cc(Cl)ccc2OC)cc1 |
| InChI | InChI=1S/C21H26ClN3O5S/c1-4-25(5-2)31(28,29)17-9-6-15(7-10-17)12-13-23-20(26)21(27)24-18-14-16(22)8-11-19(18)30-3/h6-11,14H,4-5,12-13H2,1-3H3,(H,23,26)(H,24,27) |
| InChIKey | RKCYPWFMAKIYND-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.98 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|