C19H20N6O3 — CID 3012843
6-amino-1-methyl-4-oxo-7-(4-pyrazin-2-ylpiperazin-1-yl)quinoline-3-carboxylic acid (PubChem CID 3012843) has the molecular formula C19H20N6O3 and a molecular weight of 380.41 g/mol. Its IUPAC name is 6-amino-1-methyl-4-oxo-7-(4-pyrazin-2-ylpiperazin-1-yl)quinoline-3-carboxylic acid.
| Compound Name | 6-amino-1-methyl-4-oxo-7-(4-pyrazin-2-ylpiperazin-1-yl)quinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 3012843 |
| Molecular Formula | C19H20N6O3 |
| Molecular Weight | 380.41 g/mol |
| Exact Mass | 380.16 |
| IUPAC Name | 6-amino-1-methyl-4-oxo-7-(4-pyrazin-2-ylpiperazin-1-yl)quinoline-3-carboxylic acid |
| SMILES | Cn1cc(C(=O)O)c(=O)c2cc(N)c(N3CCN(c4cnccn4)CC3)cc21 |
| InChI | InChI=1S/C19H20N6O3/c1-23-11-13(19(27)28)18(26)12-8-14(20)16(9-15(12)23)24-4-6-25(7-5-24)17-10-21-2-3-22-17/h2-3,8-11H,4-7,20H2,1H3,(H,27,28) |
| InChIKey | LXAZXLQJUFDDSX-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 117.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.41 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|