C23H16ClFO2S2 — CID 3013130
4-(2-chloro-4-fluorophenyl)sulfanyl-3-(3,5-dimethylphenyl)sulfanylchromen-2-one (PubChem CID 3013130) has the molecular formula C23H16ClFO2S2 and a molecular weight of 442.96 g/mol. Its IUPAC name is 4-(2-chloro-4-fluorophenyl)sulfanyl-3-(3,5-dimethylphenyl)sulfanylchromen-2-one.
| Compound Name | 4-(2-chloro-4-fluorophenyl)sulfanyl-3-(3,5-dimethylphenyl)sulfanylchromen-2-one |
|---|---|
| PubChem CID | 3013130 |
| Molecular Formula | C23H16ClFO2S2 |
| Molecular Weight | 442.96 g/mol |
| Exact Mass | 442.03 |
| IUPAC Name | 4-(2-chloro-4-fluorophenyl)sulfanyl-3-(3,5-dimethylphenyl)sulfanylchromen-2-one |
| SMILES | Cc1cc(C)cc(Sc2c(Sc3ccc(F)cc3Cl)c3ccccc3oc2=O)c1 |
| InChI | InChI=1S/C23H16ClFO2S2/c1-13-9-14(2)11-16(10-13)28-22-21(29-20-8-7-15(25)12-18(20)24)17-5-3-4-6-19(17)27-23(22)26/h3-12H,1-2H3 |
| InChIKey | MSJLFFXRLYCEST-UHFFFAOYSA-N |
| XLogP | 7.50 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.96 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|