C15H7Cl2FO2S — CID 3013135
4-(2,5-dichlorophenyl)sulfanyl-6-fluorochromen-2-one (PubChem CID 3013135) has the molecular formula C15H7Cl2FO2S and a molecular weight of 341.19 g/mol. Its IUPAC name is 4-(2,5-dichlorophenyl)sulfanyl-6-fluorochromen-2-one.
| Compound Name | 4-(2,5-dichlorophenyl)sulfanyl-6-fluorochromen-2-one |
|---|---|
| PubChem CID | 3013135 |
| Molecular Formula | C15H7Cl2FO2S |
| Molecular Weight | 341.19 g/mol |
| Exact Mass | 339.95 |
| IUPAC Name | 4-(2,5-dichlorophenyl)sulfanyl-6-fluorochromen-2-one |
| SMILES | O=c1cc(Sc2cc(Cl)ccc2Cl)c2cc(F)ccc2o1 |
| InChI | InChI=1S/C15H7Cl2FO2S/c16-8-1-3-11(17)14(5-8)21-13-7-15(19)20-12-4-2-9(18)6-10(12)13/h1-7H |
| InChIKey | DSQZOMUKXCPTQJ-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.19 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|