C17H21N5O2 — CID 3013245
methyl 4-[2-[[amino-[(4,6-dimethylpyrimidin-2-yl)amino]methylidene]amino]ethyl]benzoate (PubChem CID 3013245) has the molecular formula C17H21N5O2 and a molecular weight of 327.39 g/mol. Its IUPAC name is methyl 4-[2-[[amino-[(4,6-dimethylpyrimidin-2-yl)amino]methylidene]amino]ethyl]benzoate.
| Compound Name | methyl 4-[2-[[amino-[(4,6-dimethylpyrimidin-2-yl)amino]methylidene]amino]ethyl]benzoate |
|---|---|
| PubChem CID | 3013245 |
| Molecular Formula | C17H21N5O2 |
| Molecular Weight | 327.39 g/mol |
| Exact Mass | 327.17 |
| IUPAC Name | methyl 4-[2-[[amino-[(4,6-dimethylpyrimidin-2-yl)amino]methylidene]amino]ethyl]benzoate |
| SMILES | COC(=O)c1ccc(CC/N=C(\N)Nc2nc(C)cc(C)n2)cc1 |
| InChI | InChI=1S/C17H21N5O2/c1-11-10-12(2)21-17(20-11)22-16(18)19-9-8-13-4-6-14(7-5-13)15(23)24-3/h4-7,10H,8-9H2,1-3H3,(H3,18,19,20,21,22) |
| InChIKey | QJGDMKPAWIAHST-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 102.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.39 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|