C15H19N5O — CID 3013269
2-{[Amino-(4,6-dimethyl-pyrimidin-2-ylamino)-methyl]-amino}-1-phenyl-ethanol (PubChem CID 3013269) has the molecular formula C15H19N5O and a molecular weight of 285.34 g/mol. Its IUPAC name is 1-(4,6-dimethylpyrimidin-2-yl)-2-[(2R)-2-hydroxy-2-phenylethyl]guanidine.
| Compound Name | 2-{[Amino-(4,6-dimethyl-pyrimidin-2-ylamino)-methyl]-amino}-1-phenyl-ethanol |
|---|---|
| PubChem CID | 3013269 |
| Molecular Formula | C15H19N5O |
| Molecular Weight | 285.34 g/mol |
| Exact Mass | 285.16 |
| IUPAC Name | 1-(4,6-dimethylpyrimidin-2-yl)-2-[(2R)-2-hydroxy-2-phenylethyl]guanidine |
| SMILES | CC1=CC(=NC(=N1)NC(=NC[C@@H](C2=CC=CC=C2)O)N)C |
| InChI | InChI=1S/C15H19N5O/c1-10-8-11(2)19-15(18-10)20-14(16)17-9-13(21)12-6-4-3-5-7-12/h3-8,13,21H,9H2,1-2H3,(H3,16,17,18,19,20)/t13-/m0/s1 |
| InChIKey | SIDRXPWELRYDEP-ZDUSSCGKSA-N |
| XLogP | 0.90 |
| TPSA | 96.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | 333 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.34 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|