C25H27N5O3 — CID 30134612
N-[4-(4-ethylpiperazin-1-yl)-2-methylphenyl]-6-(furan-2-yl)-3-methyl-[1,2]oxazolo[5,4-b]pyridine-4-carboxamide (PubChem CID 30134612) has the molecular formula C25H27N5O3 and a molecular weight of 445.52 g/mol. Its IUPAC name is N-[4-(4-ethylpiperazin-1-yl)-2-methylphenyl]-6-(furan-2-yl)-3-methyl-[1,2]oxazolo[5,4-b]pyridine-4-carboxamide.
| Compound Name | N-[4-(4-ethylpiperazin-1-yl)-2-methylphenyl]-6-(furan-2-yl)-3-methyl-[1,2]oxazolo[5,4-b]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 30134612 |
| Molecular Formula | C25H27N5O3 |
| Molecular Weight | 445.52 g/mol |
| Exact Mass | 445.21 |
| IUPAC Name | N-[4-(4-ethylpiperazin-1-yl)-2-methylphenyl]-6-(furan-2-yl)-3-methyl-[1,2]oxazolo[5,4-b]pyridine-4-carboxamide |
| SMILES | CCN1CCN(c2ccc(NC(=O)c3cc(-c4ccco4)nc4onc(C)c34)c(C)c2)CC1 |
| InChI | InChI=1S/C25H27N5O3/c1-4-29-9-11-30(12-10-29)18-7-8-20(16(2)14-18)26-24(31)19-15-21(22-6-5-13-32-22)27-25-23(19)17(3)28-33-25/h5-8,13-15H,4,9-12H2,1-3H3,(H,26,31) |
| InChIKey | SUFPTLLFKKNQQJ-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 87.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.52 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|