C24H25N5O2 — CID 18281449
6-(furan-2-yl)-1,3-dimethyl-N-(2-methyl-4-pyrrolidin-1-ylphenyl)pyrazolo[5,4-b]pyridine-4-carboxamide (PubChem CID 18281449) has the molecular formula C24H25N5O2 and a molecular weight of 415.50 g/mol. Its IUPAC name is 6-(furan-2-yl)-1,3-dimethyl-N-(2-methyl-4-pyrrolidin-1-ylphenyl)pyrazolo[5,4-b]pyridine-4-carboxamide.
| Compound Name | 6-(furan-2-yl)-1,3-dimethyl-N-(2-methyl-4-pyrrolidin-1-ylphenyl)pyrazolo[5,4-b]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 18281449 |
| Molecular Formula | C24H25N5O2 |
| Molecular Weight | 415.50 g/mol |
| Exact Mass | 415.20 |
| IUPAC Name | 6-(furan-2-yl)-1,3-dimethyl-N-(2-methyl-4-pyrrolidin-1-ylphenyl)pyrazolo[5,4-b]pyridine-4-carboxamide |
| SMILES | Cc1cc(N2CCCC2)ccc1NC(=O)c1cc(-c2ccco2)nc2c1c(C)nn2C |
| InChI | InChI=1S/C24H25N5O2/c1-15-13-17(29-10-4-5-11-29)8-9-19(15)26-24(30)18-14-20(21-7-6-12-31-21)25-23-22(18)16(2)27-28(23)3/h6-9,12-14H,4-5,10-11H2,1-3H3,(H,26,30) |
| InChIKey | ZWJQKCNHAIKGQT-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 76.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.50 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|