C22H23N5O2 — CID 55780235
N-[4-(dimethylamino)-2-methylphenyl]-6-(furan-2-yl)-1,3-dimethylpyrazolo[5,4-b]pyridine-4-carboxamide (PubChem CID 55780235) has the molecular formula C22H23N5O2 and a molecular weight of 389.46 g/mol. Its IUPAC name is N-[4-(dimethylamino)-2-methylphenyl]-6-(furan-2-yl)-1,3-dimethylpyrazolo[5,4-b]pyridine-4-carboxamide.
| Compound Name | N-[4-(dimethylamino)-2-methylphenyl]-6-(furan-2-yl)-1,3-dimethylpyrazolo[5,4-b]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 55780235 |
| Molecular Formula | C22H23N5O2 |
| Molecular Weight | 389.46 g/mol |
| Exact Mass | 389.19 |
| IUPAC Name | N-[4-(dimethylamino)-2-methylphenyl]-6-(furan-2-yl)-1,3-dimethylpyrazolo[5,4-b]pyridine-4-carboxamide |
| SMILES | Cc1cc(N(C)C)ccc1NC(=O)c1cc(-c2ccco2)nc2c1c(C)nn2C |
| InChI | InChI=1S/C22H23N5O2/c1-13-11-15(26(3)4)8-9-17(13)24-22(28)16-12-18(19-7-6-10-29-19)23-21-20(16)14(2)25-27(21)5/h6-12H,1-5H3,(H,24,28) |
| InChIKey | PFBYZKNSIVXZJX-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 76.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.46 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|