C23H25N5O2 — CID 55780289
N-[4-(dimethylamino)-2-methylphenyl]-6-(furan-2-yl)-1-propan-2-ylpyrazolo[5,4-b]pyridine-4-carboxamide (PubChem CID 55780289) has the molecular formula C23H25N5O2 and a molecular weight of 403.49 g/mol. Its IUPAC name is N-[4-(dimethylamino)-2-methylphenyl]-6-(furan-2-yl)-1-propan-2-ylpyrazolo[5,4-b]pyridine-4-carboxamide.
| Compound Name | N-[4-(dimethylamino)-2-methylphenyl]-6-(furan-2-yl)-1-propan-2-ylpyrazolo[5,4-b]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 55780289 |
| Molecular Formula | C23H25N5O2 |
| Molecular Weight | 403.49 g/mol |
| Exact Mass | 403.20 |
| IUPAC Name | N-[4-(dimethylamino)-2-methylphenyl]-6-(furan-2-yl)-1-propan-2-ylpyrazolo[5,4-b]pyridine-4-carboxamide |
| SMILES | Cc1cc(N(C)C)ccc1NC(=O)c1cc(-c2ccco2)nc2c1cnn2C(C)C |
| InChI | InChI=1S/C23H25N5O2/c1-14(2)28-22-18(13-24-28)17(12-20(25-22)21-7-6-10-30-21)23(29)26-19-9-8-16(27(4)5)11-15(19)3/h6-14H,1-5H3,(H,26,29) |
| InChIKey | OMCBDZMLOXFJPC-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 76.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.49 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|