C35H43N3O3 — CID 3013677
benzyl 3-[3-(4-benzylpiperidin-1-yl)propyl-phenylcarbamoyl]piperidine-1-carboxylate (PubChem CID 3013677) has the molecular formula C35H43N3O3 and a molecular weight of 553.75 g/mol. Its IUPAC name is benzyl 3-[3-(4-benzylpiperidin-1-yl)propyl-phenylcarbamoyl]piperidine-1-carboxylate.
| Compound Name | benzyl 3-[3-(4-benzylpiperidin-1-yl)propyl-phenylcarbamoyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 3013677 |
| Molecular Formula | C35H43N3O3 |
| Molecular Weight | 553.75 g/mol |
| Exact Mass | 553.33 |
| IUPAC Name | benzyl 3-[3-(4-benzylpiperidin-1-yl)propyl-phenylcarbamoyl]piperidine-1-carboxylate |
| SMILES | O=C(OCc1ccccc1)N1CCCC(C(=O)N(CCCN2CCC(Cc3ccccc3)CC2)c2ccccc2)C1 |
| InChI | InChI=1S/C35H43N3O3/c39-34(32-16-10-22-37(27-32)35(40)41-28-31-14-6-2-7-15-31)38(33-17-8-3-9-18-33)23-11-21-36-24-19-30(20-25-36)26-29-12-4-1-5-13-29/h1-9,12-15,17-18,30,32H,10-11,16,19-28H2 |
| InChIKey | NAMNVKJJMXSBMN-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 53.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.75 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |