C18H23N5OS — CID 30139703
1-methyl-3-[[4-[(3-methyl-1,2-oxazol-5-yl)methyl]piperazin-1-yl]methyl]benzimidazole-2-thione (PubChem CID 30139703) has the molecular formula C18H23N5OS and a molecular weight of 357.48 g/mol. Its IUPAC name is 1-methyl-3-[[4-[(3-methyl-1,2-oxazol-5-yl)methyl]piperazin-1-yl]methyl]benzimidazole-2-thione.
| Compound Name | 1-methyl-3-[[4-[(3-methyl-1,2-oxazol-5-yl)methyl]piperazin-1-yl]methyl]benzimidazole-2-thione |
|---|---|
| PubChem CID | 30139703 |
| Molecular Formula | C18H23N5OS |
| Molecular Weight | 357.48 g/mol |
| Exact Mass | 357.16 |
| IUPAC Name | 1-methyl-3-[[4-[(3-methyl-1,2-oxazol-5-yl)methyl]piperazin-1-yl]methyl]benzimidazole-2-thione |
| SMILES | Cc1cc(CN2CCN(Cn3c(=S)n(C)c4ccccc43)CC2)on1 |
| InChI | InChI=1S/C18H23N5OS/c1-14-11-15(24-19-14)12-21-7-9-22(10-8-21)13-23-17-6-4-3-5-16(17)20(2)18(23)25/h3-6,11H,7-10,12-13H2,1-2H3 |
| InChIKey | AIXOZVULKKWVHK-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 42.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.48 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|