C16H25N3O4S — CID 30148664
N-[3-(4-ethylpiperazine-1-carbonyl)-4-methoxyphenyl]-N-methylmethanesulfonamide (PubChem CID 30148664) has the molecular formula C16H25N3O4S and a molecular weight of 355.46 g/mol. Its IUPAC name is N-[3-(4-ethylpiperazine-1-carbonyl)-4-methoxyphenyl]-N-methylmethanesulfonamide.
| Compound Name | N-[3-(4-ethylpiperazine-1-carbonyl)-4-methoxyphenyl]-N-methylmethanesulfonamide |
|---|---|
| PubChem CID | 30148664 |
| Molecular Formula | C16H25N3O4S |
| Molecular Weight | 355.46 g/mol |
| Exact Mass | 355.16 |
| IUPAC Name | N-[3-(4-ethylpiperazine-1-carbonyl)-4-methoxyphenyl]-N-methylmethanesulfonamide |
| SMILES | CCN1CCN(C(=O)c2cc(N(C)S(C)(=O)=O)ccc2OC)CC1 |
| InChI | InChI=1S/C16H25N3O4S/c1-5-18-8-10-19(11-9-18)16(20)14-12-13(6-7-15(14)23-3)17(2)24(4,21)22/h6-7,12H,5,8-11H2,1-4H3 |
| InChIKey | JAGNMDDKCQVEIH-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 70.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.46 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |