C17H25N3O6S — CID 30148645
ethyl 4-[2-methoxy-5-[methyl(methylsulfonyl)amino]benzoyl]piperazine-1-carboxylate (PubChem CID 30148645) has the molecular formula C17H25N3O6S and a molecular weight of 399.47 g/mol. Its IUPAC name is ethyl 4-[2-methoxy-5-[methyl(methylsulfonyl)amino]benzoyl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[2-methoxy-5-[methyl(methylsulfonyl)amino]benzoyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 30148645 |
| Molecular Formula | C17H25N3O6S |
| Molecular Weight | 399.47 g/mol |
| Exact Mass | 399.15 |
| IUPAC Name | ethyl 4-[2-methoxy-5-[methyl(methylsulfonyl)amino]benzoyl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(C(=O)c2cc(N(C)S(C)(=O)=O)ccc2OC)CC1 |
| InChI | InChI=1S/C17H25N3O6S/c1-5-26-17(22)20-10-8-19(9-11-20)16(21)14-12-13(6-7-15(14)25-3)18(2)27(4,23)24/h6-7,12H,5,8-11H2,1-4H3 |
| InChIKey | OIXDLYRPHZHUSD-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 96.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.47 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |