C17H21IN4O2 — CID 30148674
N-(3-iodophenyl)-2-[4-[(3-methyl-1,2-oxazol-5-yl)methyl]piperazin-1-yl]acetamide (PubChem CID 30148674) has the molecular formula C17H21IN4O2 and a molecular weight of 440.29 g/mol. Its IUPAC name is N-(3-iodophenyl)-2-[4-[(3-methyl-1,2-oxazol-5-yl)methyl]piperazin-1-yl]acetamide.
| Compound Name | N-(3-iodophenyl)-2-[4-[(3-methyl-1,2-oxazol-5-yl)methyl]piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 30148674 |
| Molecular Formula | C17H21IN4O2 |
| Molecular Weight | 440.29 g/mol |
| Exact Mass | 440.07 |
| IUPAC Name | N-(3-iodophenyl)-2-[4-[(3-methyl-1,2-oxazol-5-yl)methyl]piperazin-1-yl]acetamide |
| SMILES | Cc1cc(CN2CCN(CC(=O)Nc3cccc(I)c3)CC2)on1 |
| InChI | InChI=1S/C17H21IN4O2/c1-13-9-16(24-20-13)11-21-5-7-22(8-6-21)12-17(23)19-15-4-2-3-14(18)10-15/h2-4,9-10H,5-8,11-12H2,1H3,(H,19,23) |
| InChIKey | LTGIXKVDJDHQGO-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 61.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.29 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|