C11H10ClNS — CID 3015874
2-benzyl-4-(chloromethyl)-1,3-thiazole (PubChem CID 3015874) has the molecular formula C11H10ClNS and a molecular weight of 223.73 g/mol. Its IUPAC name is 2-benzyl-4-(chloromethyl)-1,3-thiazole.
| Compound Name | 2-benzyl-4-(chloromethyl)-1,3-thiazole |
|---|---|
| PubChem CID | 3015874 |
| Molecular Formula | C11H10ClNS |
| Molecular Weight | 223.73 g/mol |
| Exact Mass | 223.02 |
| IUPAC Name | 2-benzyl-4-(chloromethyl)-1,3-thiazole |
| SMILES | ClCc1csc(Cc2ccccc2)n1 |
| InChI | InChI=1S/C11H10ClNS/c12-7-10-8-14-11(13-10)6-9-4-2-1-3-5-9/h1-5,8H,6-7H2 |
| InChIKey | OBQYFPBESLPHHK-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.73 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|