C13H19NO — CID 3016739
5-methoxy-N-propan-2-yl-2,3-dihydro-1H-inden-1-amine (PubChem CID 3016739) has the molecular formula C13H19NO and a molecular weight of 205.30 g/mol. Its IUPAC name is 5-methoxy-N-propan-2-yl-2,3-dihydro-1H-inden-1-amine.
| Compound Name | 5-methoxy-N-propan-2-yl-2,3-dihydro-1H-inden-1-amine |
|---|---|
| PubChem CID | 3016739 |
| Molecular Formula | C13H19NO |
| Molecular Weight | 205.30 g/mol |
| Exact Mass | 205.15 |
| IUPAC Name | 5-methoxy-N-propan-2-yl-2,3-dihydro-1H-inden-1-amine |
| SMILES | COc1ccc2c(c1)CCC2NC(C)C |
| InChI | InChI=1S/C13H19NO/c1-9(2)14-13-7-4-10-8-11(15-3)5-6-12(10)13/h5-6,8-9,13-14H,4,7H2,1-3H3 |
| InChIKey | XWRFGUJJTUYOPT-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.30 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |