C21H26N2O3S — CID 30173781
N-benzyl-N-[(2R)-butan-2-yl]-3-(1,1-dioxo-1,2-thiazolidin-2-yl)benzamide (PubChem CID 30173781) has the molecular formula C21H26N2O3S and a molecular weight of 386.52 g/mol. Its IUPAC name is N-benzyl-N-[(2R)-butan-2-yl]-3-(1,1-dioxo-1,2-thiazolidin-2-yl)benzamide.
| Compound Name | N-benzyl-N-[(2R)-butan-2-yl]-3-(1,1-dioxo-1,2-thiazolidin-2-yl)benzamide |
|---|---|
| PubChem CID | 30173781 |
| Molecular Formula | C21H26N2O3S |
| Molecular Weight | 386.52 g/mol |
| Exact Mass | 386.17 |
| IUPAC Name | N-benzyl-N-[(2R)-butan-2-yl]-3-(1,1-dioxo-1,2-thiazolidin-2-yl)benzamide |
| SMILES | CC[C@@H](C)N(Cc1ccccc1)C(=O)c1cccc(N2CCCS2(=O)=O)c1 |
| InChI | InChI=1S/C21H26N2O3S/c1-3-17(2)22(16-18-9-5-4-6-10-18)21(24)19-11-7-12-20(15-19)23-13-8-14-27(23,25)26/h4-7,9-12,15,17H,3,8,13-14,16H2,1-2H3/t17-/m1/s1 |
| InChIKey | VAIKTNHHNAEWMS-QGZVFWFLSA-N |
| XLogP | 3.67 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.52 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |