C19H18N4O3S — CID 30177914
[2-[bis(2-cyanoethyl)amino]-2-oxoethyl] 2-methyl-6-thiophen-2-ylpyridine-3-carboxylate (PubChem CID 30177914) has the molecular formula C19H18N4O3S and a molecular weight of 382.45 g/mol. Its IUPAC name is [2-[bis(2-cyanoethyl)amino]-2-oxoethyl] 2-methyl-6-thiophen-2-ylpyridine-3-carboxylate.
| Compound Name | [2-[bis(2-cyanoethyl)amino]-2-oxoethyl] 2-methyl-6-thiophen-2-ylpyridine-3-carboxylate |
|---|---|
| PubChem CID | 30177914 |
| Molecular Formula | C19H18N4O3S |
| Molecular Weight | 382.45 g/mol |
| Exact Mass | 382.11 |
| IUPAC Name | [2-[bis(2-cyanoethyl)amino]-2-oxoethyl] 2-methyl-6-thiophen-2-ylpyridine-3-carboxylate |
| SMILES | Cc1nc(-c2cccs2)ccc1C(=O)OCC(=O)N(CCC#N)CCC#N |
| InChI | InChI=1S/C19H18N4O3S/c1-14-15(6-7-16(22-14)17-5-2-12-27-17)19(25)26-13-18(24)23(10-3-8-20)11-4-9-21/h2,5-7,12H,3-4,10-11,13H2,1H3 |
| InChIKey | MPLJBSBQYGFWNN-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 107.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.45 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |