About 8,8-diethoxy-2,6-dimethyloct-2-ene
8,8-diethoxy-2,6-dimethyloct-2-ene (PubChem CID 3018210) has the molecular formula C14H28O2
and a molecular weight of 228.38 g/mol. Its IUPAC name is 8,8-diethoxy-2,6-dimethyloct-2-ene.
Molecular Properties
| Compound Name | 8,8-diethoxy-2,6-dimethyloct-2-ene |
| PubChem CID | 3018210 |
| Molecular Formula | C14H28O2 |
| Molecular Weight | 228.38 g/mol |
| Exact Mass | 228.21 |
| IUPAC Name | 8,8-diethoxy-2,6-dimethyloct-2-ene |
| SMILES | CCOC(CC(C)CCC=C(C)C)OCC |
| InChI | InChI=1S/C14H28O2/c1-6-15-14(16-7-2)11-13(5)10-8-9-12(3)4/h9,13-14H,6-8,10-11H2,1-5H3 |
| InChIKey | HYNXWFKVWMABRM-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.38 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 8,8-diethoxy-2,6-dimethyloct-2-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8,8-diethoxy-2,6-dimethyloct-2-ene?
The IUPAC name of 8,8-diethoxy-2,6-dimethyloct-2-ene (CID 3018210) is 8,8-diethoxy-2,6-dimethyloct-2-ene.
What is the SMILES notation for 8,8-diethoxy-2,6-dimethyloct-2-ene?
The canonical SMILES for 8,8-diethoxy-2,6-dimethyloct-2-ene is CCOC(CC(C)CCC=C(C)C)OCC.
What is the InChIKey of 8,8-diethoxy-2,6-dimethyloct-2-ene?
The InChIKey is HYNXWFKVWMABRM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H28O2/c1-6-15-14(16-7-2)11-13(5)10-8-9-12(3)4/h9,13-14H,6-8,10-11H2,1-5H3.
What are the key properties of 8,8-diethoxy-2,6-dimethyloct-2-ene?
8,8-diethoxy-2,6-dimethyloct-2-ene has a molecular weight of 228.38 g/mol, XLogP of 4.16, 9 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8,8-diethoxy-2,6-dimethyloct-2-ene is sourced from PubChem (CID 3018210), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).