C13H11NO7 — CID 3018786
3-(2,5-dioxopyrrolidin-1-yl)oxy-2-(4-hydroxyphenyl)-3-oxopropanoic acid (PubChem CID 3018786) has the molecular formula C13H11NO7 and a molecular weight of 293.23 g/mol. Its IUPAC name is 3-(2,5-dioxopyrrolidin-1-yl)oxy-2-(4-hydroxyphenyl)-3-oxopropanoic acid.
| Compound Name | 3-(2,5-dioxopyrrolidin-1-yl)oxy-2-(4-hydroxyphenyl)-3-oxopropanoic acid |
|---|---|
| PubChem CID | 3018786 |
| Molecular Formula | C13H11NO7 |
| Molecular Weight | 293.23 g/mol |
| Exact Mass | 293.05 |
| IUPAC Name | 3-(2,5-dioxopyrrolidin-1-yl)oxy-2-(4-hydroxyphenyl)-3-oxopropanoic acid |
| SMILES | O=C(O)C(C(=O)ON1C(=O)CCC1=O)c1ccc(O)cc1 |
| InChI | InChI=1S/C13H11NO7/c15-8-3-1-7(2-4-8)11(12(18)19)13(20)21-14-9(16)5-6-10(14)17/h1-4,11,15H,5-6H2,(H,18,19) |
| InChIKey | YURJEDJHWHEGRT-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 121.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.23 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|