C22H27Cl2NO9S — CID 3018957
1,5-bis[[2-(4-chlorophenoxy)acetyl]oxy]pentan-3-ylazanium;methanesulfonate (PubChem CID 3018957) has the molecular formula C22H27Cl2NO9S and a molecular weight of 552.43 g/mol. Its IUPAC name is 1,5-bis[[2-(4-chlorophenoxy)acetyl]oxy]pentan-3-ylazanium;methanesulfonate.
| Compound Name | 1,5-bis[[2-(4-chlorophenoxy)acetyl]oxy]pentan-3-ylazanium;methanesulfonate |
|---|---|
| PubChem CID | 3018957 |
| Molecular Formula | C22H27Cl2NO9S |
| Molecular Weight | 552.43 g/mol |
| Exact Mass | 551.08 |
| IUPAC Name | 1,5-bis[[2-(4-chlorophenoxy)acetyl]oxy]pentan-3-ylazanium;methanesulfonate |
| SMILES | CS(=O)(=O)[O-].[NH3+]C(CCOC(=O)COc1ccc(Cl)cc1)CCOC(=O)COc1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H23Cl2NO6.CH4O3S/c22-15-1-5-18(6-2-15)29-13-20(25)27-11-9-17(24)10-12-28-21(26)14-30-19-7-3-16(23)4-8-19;1-5(2,3)4/h1-8,17H,9-14,24H2;1H3,(H,2,3,4) |
| InChIKey | ZOAQOBLESJWAMZ-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 155.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.43 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|