C14H13N3O — CID 3021567
7-imidazol-1-yl-5,6-dihydronaphthalene-2-carboxamide (PubChem CID 3021567) has the molecular formula C14H13N3O and a molecular weight of 239.28 g/mol. Its IUPAC name is 7-imidazol-1-yl-5,6-dihydronaphthalene-2-carboxamide.
| Compound Name | 7-imidazol-1-yl-5,6-dihydronaphthalene-2-carboxamide |
|---|---|
| PubChem CID | 3021567 |
| Molecular Formula | C14H13N3O |
| Molecular Weight | 239.28 g/mol |
| Exact Mass | 239.11 |
| IUPAC Name | 7-imidazol-1-yl-5,6-dihydronaphthalene-2-carboxamide |
| SMILES | NC(=O)c1ccc2c(c1)C=C(n1ccnc1)CC2 |
| InChI | InChI=1S/C14H13N3O/c15-14(18)11-2-1-10-3-4-13(8-12(10)7-11)17-6-5-16-9-17/h1-2,5-9H,3-4H2,(H2,15,18) |
| InChIKey | WDHWKRIHZFKPAB-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 60.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.28 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |