C15H24N2O3S — CID 30218239
N-(2-methylbutan-2-yl)-2-(4-methyl-N-methylsulfonylanilino)acetamide (PubChem CID 30218239) has the molecular formula C15H24N2O3S and a molecular weight of 312.44 g/mol. Its IUPAC name is N-(2-methylbutan-2-yl)-2-(4-methyl-N-methylsulfonylanilino)acetamide.
| Compound Name | N-(2-methylbutan-2-yl)-2-(4-methyl-N-methylsulfonylanilino)acetamide |
|---|---|
| PubChem CID | 30218239 |
| Molecular Formula | C15H24N2O3S |
| Molecular Weight | 312.44 g/mol |
| Exact Mass | 312.15 |
| IUPAC Name | N-(2-methylbutan-2-yl)-2-(4-methyl-N-methylsulfonylanilino)acetamide |
| SMILES | CCC(C)(C)NC(=O)CN(c1ccc(C)cc1)S(C)(=O)=O |
| InChI | InChI=1S/C15H24N2O3S/c1-6-15(3,4)16-14(18)11-17(21(5,19)20)13-9-7-12(2)8-10-13/h7-10H,6,11H2,1-5H3,(H,16,18) |
| InChIKey | RWLWWANREAIDOS-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.44 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |