C20H18N2 — CID 3021935
1-phenyl-3-(1,2,3,6-tetrahydropyridin-5-yl)isoquinoline (PubChem CID 3021935) has the molecular formula C20H18N2 and a molecular weight of 286.38 g/mol. Its IUPAC name is 1-phenyl-3-(1,2,3,6-tetrahydropyridin-5-yl)isoquinoline.
| Compound Name | 1-phenyl-3-(1,2,3,6-tetrahydropyridin-5-yl)isoquinoline |
|---|---|
| PubChem CID | 3021935 |
| Molecular Formula | C20H18N2 |
| Molecular Weight | 286.38 g/mol |
| Exact Mass | 286.15 |
| IUPAC Name | 1-phenyl-3-(1,2,3,6-tetrahydropyridin-5-yl)isoquinoline |
| SMILES | C1=C(c2cc3ccccc3c(-c3ccccc3)n2)CNCC1 |
| InChI | InChI=1S/C20H18N2/c1-2-7-15(8-3-1)20-18-11-5-4-9-16(18)13-19(22-20)17-10-6-12-21-14-17/h1-5,7-11,13,21H,6,12,14H2 |
| InChIKey | BNVNRFIRMHZENS-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.38 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |