C14H15N3 — CID 118393144
2-phenyl-5,6,7,8-tetrahydro-1,7-naphthyridin-3-amine (PubChem CID 118393144) has the molecular formula C14H15N3 and a molecular weight of 225.30 g/mol. Its IUPAC name is 2-phenyl-5,6,7,8-tetrahydro-1,7-naphthyridin-3-amine.
| Compound Name | 2-phenyl-5,6,7,8-tetrahydro-1,7-naphthyridin-3-amine |
|---|---|
| PubChem CID | 118393144 |
| Molecular Formula | C14H15N3 |
| Molecular Weight | 225.30 g/mol |
| Exact Mass | 225.13 |
| IUPAC Name | 2-phenyl-5,6,7,8-tetrahydro-1,7-naphthyridin-3-amine |
| SMILES | Nc1cc2c(nc1-c1ccccc1)CNCC2 |
| InChI | InChI=1S/C14H15N3/c15-12-8-11-6-7-16-9-13(11)17-14(12)10-4-2-1-3-5-10/h1-5,8,16H,6-7,9,15H2 |
| InChIKey | VVBTXZXYKASRRZ-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.30 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |