About 3-hexoxy-2-oxopropanal
3-hexoxy-2-oxopropanal (PubChem CID 3022761) has the molecular formula C9H16O3
and a molecular weight of 172.22 g/mol. Its IUPAC name is 3-hexoxy-2-oxopropanal.
Molecular Properties
| Compound Name | 3-hexoxy-2-oxopropanal |
| PubChem CID | 3022761 |
| Molecular Formula | C9H16O3 |
| Molecular Weight | 172.22 g/mol |
| Exact Mass | 172.11 |
| IUPAC Name | 3-hexoxy-2-oxopropanal |
| SMILES | CCCCCCOCC(=O)C=O |
| InChI | InChI=1S/C9H16O3/c1-2-3-4-5-6-12-8-9(11)7-10/h7H,2-6,8H2,1H3 |
| InChIKey | DGWQOGPDRHHXCF-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.22 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 3-hexoxy-2-oxopropanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-hexoxy-2-oxopropanal?
The IUPAC name of 3-hexoxy-2-oxopropanal (CID 3022761) is 3-hexoxy-2-oxopropanal.
What is the SMILES notation for 3-hexoxy-2-oxopropanal?
The canonical SMILES for 3-hexoxy-2-oxopropanal is CCCCCCOCC(=O)C=O.
What is the InChIKey of 3-hexoxy-2-oxopropanal?
The InChIKey is DGWQOGPDRHHXCF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16O3/c1-2-3-4-5-6-12-8-9(11)7-10/h7H,2-6,8H2,1H3.
What are the key properties of 3-hexoxy-2-oxopropanal?
3-hexoxy-2-oxopropanal has a molecular weight of 172.22 g/mol, XLogP of 1.35, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-hexoxy-2-oxopropanal is sourced from PubChem (CID 3022761), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).