C25H25FN2O6S — CID 30244929
2-[N-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)-4-fluoroanilino]-N-[2-(4-methylphenoxy)ethyl]acetamide (PubChem CID 30244929) has the molecular formula C25H25FN2O6S and a molecular weight of 500.55 g/mol. Its IUPAC name is 2-[N-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)-4-fluoroanilino]-N-[2-(4-methylphenoxy)ethyl]acetamide.
| Compound Name | 2-[N-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)-4-fluoroanilino]-N-[2-(4-methylphenoxy)ethyl]acetamide |
|---|---|
| PubChem CID | 30244929 |
| Molecular Formula | C25H25FN2O6S |
| Molecular Weight | 500.55 g/mol |
| Exact Mass | 500.14 |
| IUPAC Name | 2-[N-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)-4-fluoroanilino]-N-[2-(4-methylphenoxy)ethyl]acetamide |
| SMILES | Cc1ccc(OCCNC(=O)CN(c2ccc(F)cc2)S(=O)(=O)c2ccc3c(c2)OCCO3)cc1 |
| InChI | InChI=1S/C25H25FN2O6S/c1-18-2-8-21(9-3-18)32-13-12-27-25(29)17-28(20-6-4-19(26)5-7-20)35(30,31)22-10-11-23-24(16-22)34-15-14-33-23/h2-11,16H,12-15,17H2,1H3,(H,27,29) |
| InChIKey | PIOJLMWQWCNQEF-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.55 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|