C28H31FN2O6S — CID 43898327
2-[N-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)-4-fluoroanilino]-N-[3-(3-propan-2-yloxyphenyl)propyl]acetamide (PubChem CID 43898327) has the molecular formula C28H31FN2O6S and a molecular weight of 542.63 g/mol. Its IUPAC name is 2-[N-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)-4-fluoroanilino]-N-[3-(3-propan-2-yloxyphenyl)propyl]acetamide.
| Compound Name | 2-[N-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)-4-fluoroanilino]-N-[3-(3-propan-2-yloxyphenyl)propyl]acetamide |
|---|---|
| PubChem CID | 43898327 |
| Molecular Formula | C28H31FN2O6S |
| Molecular Weight | 542.63 g/mol |
| Exact Mass | 542.19 |
| IUPAC Name | 2-[N-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)-4-fluoroanilino]-N-[3-(3-propan-2-yloxyphenyl)propyl]acetamide |
| SMILES | CC(C)Oc1cccc(CCCNC(=O)CN(c2ccc(F)cc2)S(=O)(=O)c2ccc3c(c2)OCCO3)c1 |
| InChI | InChI=1S/C28H31FN2O6S/c1-20(2)37-24-7-3-5-21(17-24)6-4-14-30-28(32)19-31(23-10-8-22(29)9-11-23)38(33,34)25-12-13-26-27(18-25)36-16-15-35-26/h3,5,7-13,17-18,20H,4,6,14-16,19H2,1-2H3,(H,30,32) |
| InChIKey | AYKIJJPZOJQKDL-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.63 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|