C18H22N2O5S — CID 30257135
(2,3,6-trimethylphenyl) 1-[(3R)-1,1-dioxothiolan-3-yl]-6-oxo-4,5-dihydropyridazine-3-carboxylate (PubChem CID 30257135) has the molecular formula C18H22N2O5S and a molecular weight of 378.45 g/mol. Its IUPAC name is (2,3,6-trimethylphenyl) 1-[(3R)-1,1-dioxothiolan-3-yl]-6-oxo-4,5-dihydropyridazine-3-carboxylate.
| Compound Name | (2,3,6-trimethylphenyl) 1-[(3R)-1,1-dioxothiolan-3-yl]-6-oxo-4,5-dihydropyridazine-3-carboxylate |
|---|---|
| PubChem CID | 30257135 |
| Molecular Formula | C18H22N2O5S |
| Molecular Weight | 378.45 g/mol |
| Exact Mass | 378.12 |
| IUPAC Name | (2,3,6-trimethylphenyl) 1-[(3R)-1,1-dioxothiolan-3-yl]-6-oxo-4,5-dihydropyridazine-3-carboxylate |
| SMILES | Cc1ccc(C)c(OC(=O)C2=NN([C@@H]3CCS(=O)(=O)C3)C(=O)CC2)c1C |
| InChI | InChI=1S/C18H22N2O5S/c1-11-4-5-12(2)17(13(11)3)25-18(22)15-6-7-16(21)20(19-15)14-8-9-26(23,24)10-14/h4-5,14H,6-10H2,1-3H3/t14-/m1/s1 |
| InChIKey | LRRGXVYOEIAAEB-CQSZACIVSA-N |
| XLogP | 1.68 |
| TPSA | 93.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.45 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|