C17H19ClN2O6S — CID 7677502
2-(4-chlorophenoxy)ethyl 1-[(3R)-1,1-dioxothiolan-3-yl]-6-oxo-4,5-dihydropyridazine-3-carboxylate (PubChem CID 7677502) has the molecular formula C17H19ClN2O6S and a molecular weight of 414.87 g/mol. Its IUPAC name is 2-(4-chlorophenoxy)ethyl 1-[(3R)-1,1-dioxothiolan-3-yl]-6-oxo-4,5-dihydropyridazine-3-carboxylate.
| Compound Name | 2-(4-chlorophenoxy)ethyl 1-[(3R)-1,1-dioxothiolan-3-yl]-6-oxo-4,5-dihydropyridazine-3-carboxylate |
|---|---|
| PubChem CID | 7677502 |
| Molecular Formula | C17H19ClN2O6S |
| Molecular Weight | 414.87 g/mol |
| Exact Mass | 414.07 |
| IUPAC Name | 2-(4-chlorophenoxy)ethyl 1-[(3R)-1,1-dioxothiolan-3-yl]-6-oxo-4,5-dihydropyridazine-3-carboxylate |
| SMILES | O=C(OCCOc1ccc(Cl)cc1)C1=NN([C@@H]2CCS(=O)(=O)C2)C(=O)CC1 |
| InChI | InChI=1S/C17H19ClN2O6S/c18-12-1-3-14(4-2-12)25-8-9-26-17(22)15-5-6-16(21)20(19-15)13-7-10-27(23,24)11-13/h1-4,13H,5-11H2/t13-/m1/s1 |
| InChIKey | GRXDVNJCOHLERV-CYBMUJFWSA-N |
| XLogP | 1.43 |
| TPSA | 102.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.87 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|