C17H19FN2O6S — CID 42899236
2-(2-fluorophenoxy)ethyl 1-(1,1-dioxothiolan-3-yl)-6-oxo-4,5-dihydropyridazine-3-carboxylate (PubChem CID 42899236) has the molecular formula C17H19FN2O6S and a molecular weight of 398.41 g/mol. Its IUPAC name is 2-(2-fluorophenoxy)ethyl 1-(1,1-dioxothiolan-3-yl)-6-oxo-4,5-dihydropyridazine-3-carboxylate.
| Compound Name | 2-(2-fluorophenoxy)ethyl 1-(1,1-dioxothiolan-3-yl)-6-oxo-4,5-dihydropyridazine-3-carboxylate |
|---|---|
| PubChem CID | 42899236 |
| Molecular Formula | C17H19FN2O6S |
| Molecular Weight | 398.41 g/mol |
| Exact Mass | 398.09 |
| IUPAC Name | 2-(2-fluorophenoxy)ethyl 1-(1,1-dioxothiolan-3-yl)-6-oxo-4,5-dihydropyridazine-3-carboxylate |
| SMILES | O=C(OCCOc1ccccc1F)C1=NN(C2CCS(=O)(=O)C2)C(=O)CC1 |
| InChI | InChI=1S/C17H19FN2O6S/c18-13-3-1-2-4-15(13)25-8-9-26-17(22)14-5-6-16(21)20(19-14)12-7-10-27(23,24)11-12/h1-4,12H,5-11H2 |
| InChIKey | COJSAUHZMANNRU-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 102.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.41 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|