C18H22FN3O5S — CID 46452054
1-(1,1-dioxothiolan-3-yl)-N-[3-(2-fluorophenoxy)propyl]-6-oxo-4,5-dihydropyridazine-3-carboxamide (PubChem CID 46452054) has the molecular formula C18H22FN3O5S and a molecular weight of 411.46 g/mol. Its IUPAC name is 1-(1,1-dioxothiolan-3-yl)-N-[3-(2-fluorophenoxy)propyl]-6-oxo-4,5-dihydropyridazine-3-carboxamide.
| Compound Name | 1-(1,1-dioxothiolan-3-yl)-N-[3-(2-fluorophenoxy)propyl]-6-oxo-4,5-dihydropyridazine-3-carboxamide |
|---|---|
| PubChem CID | 46452054 |
| Molecular Formula | C18H22FN3O5S |
| Molecular Weight | 411.46 g/mol |
| Exact Mass | 411.13 |
| IUPAC Name | 1-(1,1-dioxothiolan-3-yl)-N-[3-(2-fluorophenoxy)propyl]-6-oxo-4,5-dihydropyridazine-3-carboxamide |
| SMILES | O=C(NCCCOc1ccccc1F)C1=NN(C2CCS(=O)(=O)C2)C(=O)CC1 |
| InChI | InChI=1S/C18H22FN3O5S/c19-14-4-1-2-5-16(14)27-10-3-9-20-18(24)15-6-7-17(23)22(21-15)13-8-11-28(25,26)12-13/h1-2,4-5,13H,3,6-12H2,(H,20,24) |
| InChIKey | ZCBRHZCFAQOMGY-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 105.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.46 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|