C15H21N5O4S — CID 92613837
1-[(3R)-1,1-dioxothiolan-3-yl]-6-oxo-N-(3-pyrazol-1-ylpropyl)-4,5-dihydropyridazine-3-carboxamide (PubChem CID 92613837) has the molecular formula C15H21N5O4S and a molecular weight of 367.43 g/mol. Its IUPAC name is 1-[(3R)-1,1-dioxothiolan-3-yl]-6-oxo-N-(3-pyrazol-1-ylpropyl)-4,5-dihydropyridazine-3-carboxamide.
| Compound Name | 1-[(3R)-1,1-dioxothiolan-3-yl]-6-oxo-N-(3-pyrazol-1-ylpropyl)-4,5-dihydropyridazine-3-carboxamide |
|---|---|
| PubChem CID | 92613837 |
| Molecular Formula | C15H21N5O4S |
| Molecular Weight | 367.43 g/mol |
| Exact Mass | 367.13 |
| IUPAC Name | 1-[(3R)-1,1-dioxothiolan-3-yl]-6-oxo-N-(3-pyrazol-1-ylpropyl)-4,5-dihydropyridazine-3-carboxamide |
| SMILES | O=C(NCCCn1cccn1)C1=NN([C@@H]2CCS(=O)(=O)C2)C(=O)CC1 |
| InChI | InChI=1S/C15H21N5O4S/c21-14-4-3-13(18-20(14)12-5-10-25(23,24)11-12)15(22)16-6-1-8-19-9-2-7-17-19/h2,7,9,12H,1,3-6,8,10-11H2,(H,16,22)/t12-/m1/s1 |
| InChIKey | DSSOYQFIABORRS-GFCCVEGCSA-N |
| XLogP | -0.45 |
| TPSA | 113.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.43 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|