C12H15N3O4S — CID 47106876
1-(1,1-dioxothiolan-3-yl)-6-oxo-N-prop-2-ynyl-4,5-dihydropyridazine-3-carboxamide (PubChem CID 47106876) has the molecular formula C12H15N3O4S and a molecular weight of 297.34 g/mol. Its IUPAC name is 1-(1,1-dioxothiolan-3-yl)-6-oxo-N-prop-2-ynyl-4,5-dihydropyridazine-3-carboxamide.
| Compound Name | 1-(1,1-dioxothiolan-3-yl)-6-oxo-N-prop-2-ynyl-4,5-dihydropyridazine-3-carboxamide |
|---|---|
| PubChem CID | 47106876 |
| Molecular Formula | C12H15N3O4S |
| Molecular Weight | 297.34 g/mol |
| Exact Mass | 297.08 |
| IUPAC Name | 1-(1,1-dioxothiolan-3-yl)-6-oxo-N-prop-2-ynyl-4,5-dihydropyridazine-3-carboxamide |
| SMILES | C#CCNC(=O)C1=NN(C2CCS(=O)(=O)C2)C(=O)CC1 |
| InChI | InChI=1S/C12H15N3O4S/c1-2-6-13-12(17)10-3-4-11(16)15(14-10)9-5-7-20(18,19)8-9/h1,9H,3-8H2,(H,13,17) |
| InChIKey | NZDMZLXPINYOBY-UHFFFAOYSA-N |
| XLogP | -1.10 |
| TPSA | 95.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.34 |
| LogP ≤ 5 | -1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|