C18H28N4O5S — CID 55806099
N-[2-(cyclohexanecarbonylamino)ethyl]-1-(1,1-dioxothiolan-3-yl)-6-oxo-4,5-dihydropyridazine-3-carboxamide (PubChem CID 55806099) has the molecular formula C18H28N4O5S and a molecular weight of 412.51 g/mol. Its IUPAC name is N-[2-(cyclohexanecarbonylamino)ethyl]-1-(1,1-dioxothiolan-3-yl)-6-oxo-4,5-dihydropyridazine-3-carboxamide.
| Compound Name | N-[2-(cyclohexanecarbonylamino)ethyl]-1-(1,1-dioxothiolan-3-yl)-6-oxo-4,5-dihydropyridazine-3-carboxamide |
|---|---|
| PubChem CID | 55806099 |
| Molecular Formula | C18H28N4O5S |
| Molecular Weight | 412.51 g/mol |
| Exact Mass | 412.18 |
| IUPAC Name | N-[2-(cyclohexanecarbonylamino)ethyl]-1-(1,1-dioxothiolan-3-yl)-6-oxo-4,5-dihydropyridazine-3-carboxamide |
| SMILES | O=C(NCCNC(=O)C1CCCCC1)C1=NN(C2CCS(=O)(=O)C2)C(=O)CC1 |
| InChI | InChI=1S/C18H28N4O5S/c23-16-7-6-15(21-22(16)14-8-11-28(26,27)12-14)18(25)20-10-9-19-17(24)13-4-2-1-3-5-13/h13-14H,1-12H2,(H,19,24)(H,20,25) |
| InChIKey | PLFMJZQNBWZAKB-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 125.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.51 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|