C21H27ClN2O3S2 — CID 30263555
N-[2-[(4-chlorophenyl)methylsulfanyl]ethyl]-2-(N-methylsulfonyl-2-propan-2-ylanilino)acetamide (PubChem CID 30263555) has the molecular formula C21H27ClN2O3S2 and a molecular weight of 455.05 g/mol. Its IUPAC name is N-[2-[(4-chlorophenyl)methylsulfanyl]ethyl]-2-(N-methylsulfonyl-2-propan-2-ylanilino)acetamide.
| Compound Name | N-[2-[(4-chlorophenyl)methylsulfanyl]ethyl]-2-(N-methylsulfonyl-2-propan-2-ylanilino)acetamide |
|---|---|
| PubChem CID | 30263555 |
| Molecular Formula | C21H27ClN2O3S2 |
| Molecular Weight | 455.05 g/mol |
| Exact Mass | 454.12 |
| IUPAC Name | N-[2-[(4-chlorophenyl)methylsulfanyl]ethyl]-2-(N-methylsulfonyl-2-propan-2-ylanilino)acetamide |
| SMILES | CC(C)c1ccccc1N(CC(=O)NCCSCc1ccc(Cl)cc1)S(C)(=O)=O |
| InChI | InChI=1S/C21H27ClN2O3S2/c1-16(2)19-6-4-5-7-20(19)24(29(3,26)27)14-21(25)23-12-13-28-15-17-8-10-18(22)11-9-17/h4-11,16H,12-15H2,1-3H3,(H,23,25) |
| InChIKey | RLHNWJAKAGPFBW-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.05 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|