C18H22N4O3 — CID 30267377
N-[4-oxo-4-[(6-pyrrolidin-1-yl-3-pyridinyl)amino]butyl]furan-2-carboxamide (PubChem CID 30267377) has the molecular formula C18H22N4O3 and a molecular weight of 342.40 g/mol. Its IUPAC name is N-[4-oxo-4-[(6-pyrrolidin-1-yl-3-pyridinyl)amino]butyl]furan-2-carboxamide.
| Compound Name | N-[4-oxo-4-[(6-pyrrolidin-1-yl-3-pyridinyl)amino]butyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 30267377 |
| Molecular Formula | C18H22N4O3 |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.17 |
| IUPAC Name | N-[4-oxo-4-[(6-pyrrolidin-1-yl-3-pyridinyl)amino]butyl]furan-2-carboxamide |
| SMILES | O=C(CCCNC(=O)c1ccco1)Nc1ccc(N2CCCC2)nc1 |
| InChI | InChI=1S/C18H22N4O3/c23-17(6-3-9-19-18(24)15-5-4-12-25-15)21-14-7-8-16(20-13-14)22-10-1-2-11-22/h4-5,7-8,12-13H,1-3,6,9-11H2,(H,19,24)(H,21,23) |
| InChIKey | OEOIQMWZVVGMTQ-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 87.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|