C16H27Cl2N3OS — CID 3027330
N,N-diethyl-2-[2-(2-methoxyethylsulfanyl)benzimidazol-1-yl]ethanamine;dihydrochloride (PubChem CID 3027330) has the molecular formula C16H27Cl2N3OS and a molecular weight of 380.39 g/mol. Its IUPAC name is N,N-diethyl-2-[2-(2-methoxyethylsulfanyl)benzimidazol-1-yl]ethanamine;dihydrochloride.
| Compound Name | N,N-diethyl-2-[2-(2-methoxyethylsulfanyl)benzimidazol-1-yl]ethanamine;dihydrochloride |
|---|---|
| PubChem CID | 3027330 |
| Molecular Formula | C16H27Cl2N3OS |
| Molecular Weight | 380.39 g/mol |
| Exact Mass | 379.13 |
| IUPAC Name | N,N-diethyl-2-[2-(2-methoxyethylsulfanyl)benzimidazol-1-yl]ethanamine;dihydrochloride |
| SMILES | CCN(CC)CCn1c(SCCOC)nc2ccccc21.Cl.Cl |
| InChI | InChI=1S/C16H25N3OS.2ClH/c1-4-18(5-2)10-11-19-15-9-7-6-8-14(15)17-16(19)21-13-12-20-3;;/h6-9H,4-5,10-13H2,1-3H3;2*1H |
| InChIKey | PMFGYUIYEIZPPE-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 30.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.39 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|