C17H16Cl2N4S — CID 3027343
2-[(1-phenylimidazol-2-yl)sulfanylmethyl]-1H-benzimidazole;dihydrochloride (PubChem CID 3027343) has the molecular formula C17H16Cl2N4S and a molecular weight of 379.32 g/mol. Its IUPAC name is 2-[(1-phenylimidazol-2-yl)sulfanylmethyl]-1H-benzimidazole;dihydrochloride.
| Compound Name | 2-[(1-phenylimidazol-2-yl)sulfanylmethyl]-1H-benzimidazole;dihydrochloride |
|---|---|
| PubChem CID | 3027343 |
| Molecular Formula | C17H16Cl2N4S |
| Molecular Weight | 379.32 g/mol |
| Exact Mass | 378.05 |
| IUPAC Name | 2-[(1-phenylimidazol-2-yl)sulfanylmethyl]-1H-benzimidazole;dihydrochloride |
| SMILES | Cl.Cl.c1ccc(-n2ccnc2SCc2nc3ccccc3[nH]2)cc1 |
| InChI | InChI=1S/C17H14N4S.2ClH/c1-2-6-13(7-3-1)21-11-10-18-17(21)22-12-16-19-14-8-4-5-9-15(14)20-16;;/h1-11H,12H2,(H,19,20);2*1H |
| InChIKey | JQBRWPINCKEVLS-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 46.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.32 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |