C21H16N4S — CID 614420
2-(1H-benzimidazol-2-ylmethylsulfanyl)-1-phenylbenzimidazole (PubChem CID 614420) has the molecular formula C21H16N4S and a molecular weight of 356.45 g/mol. Its IUPAC name is 2-(1H-benzimidazol-2-ylmethylsulfanyl)-1-phenylbenzimidazole.
| Compound Name | 2-(1H-benzimidazol-2-ylmethylsulfanyl)-1-phenylbenzimidazole |
|---|---|
| PubChem CID | 614420 |
| Molecular Formula | C21H16N4S |
| Molecular Weight | 356.45 g/mol |
| Exact Mass | 356.11 |
| IUPAC Name | 2-(1H-benzimidazol-2-ylmethylsulfanyl)-1-phenylbenzimidazole |
| SMILES | c1ccc(-n2c(SCc3nc4ccccc4[nH]3)nc3ccccc32)cc1 |
| InChI | InChI=1S/C21H16N4S/c1-2-8-15(9-3-1)25-19-13-7-6-12-18(19)24-21(25)26-14-20-22-16-10-4-5-11-17(16)23-20/h1-13H,14H2,(H,22,23) |
| InChIKey | ILKXYHQDIHVUQA-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 46.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.45 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |