C25H33N5O3S — CID 30279634
3-[5-(dimethylsulfamoyl)-1-ethylbenzimidazol-2-yl]-N-(2-piperidin-1-ylphenyl)propanamide (PubChem CID 30279634) has the molecular formula C25H33N5O3S and a molecular weight of 483.64 g/mol. Its IUPAC name is 3-[5-(dimethylsulfamoyl)-1-ethylbenzimidazol-2-yl]-N-(2-piperidin-1-ylphenyl)propanamide.
| Compound Name | 3-[5-(dimethylsulfamoyl)-1-ethylbenzimidazol-2-yl]-N-(2-piperidin-1-ylphenyl)propanamide |
|---|---|
| PubChem CID | 30279634 |
| Molecular Formula | C25H33N5O3S |
| Molecular Weight | 483.64 g/mol |
| Exact Mass | 483.23 |
| IUPAC Name | 3-[5-(dimethylsulfamoyl)-1-ethylbenzimidazol-2-yl]-N-(2-piperidin-1-ylphenyl)propanamide |
| SMILES | CCn1c(CCC(=O)Nc2ccccc2N2CCCCC2)nc2cc(S(=O)(=O)N(C)C)ccc21 |
| InChI | InChI=1S/C25H33N5O3S/c1-4-30-23-13-12-19(34(32,33)28(2)3)18-21(23)26-24(30)14-15-25(31)27-20-10-6-7-11-22(20)29-16-8-5-9-17-29/h6-7,10-13,18H,4-5,8-9,14-17H2,1-3H3,(H,27,31) |
| InChIKey | IBNUMNSZDBZDPY-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 87.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.64 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |