C20H35N3O2 — CID 30282519
3-(1-adamantylcarbamoylamino)-N,N-dipropylpropanamide (PubChem CID 30282519) has the molecular formula C20H35N3O2 and a molecular weight of 349.52 g/mol. Its IUPAC name is 3-(1-adamantylcarbamoylamino)-N,N-dipropylpropanamide.
| Compound Name | 3-(1-adamantylcarbamoylamino)-N,N-dipropylpropanamide |
|---|---|
| PubChem CID | 30282519 |
| Molecular Formula | C20H35N3O2 |
| Molecular Weight | 349.52 g/mol |
| Exact Mass | 349.27 |
| IUPAC Name | 3-(1-adamantylcarbamoylamino)-N,N-dipropylpropanamide |
| SMILES | CCCN(CCC)C(=O)CCNC(=O)NC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C20H35N3O2/c1-3-7-23(8-4-2)18(24)5-6-21-19(25)22-20-12-15-9-16(13-20)11-17(10-15)14-20/h15-17H,3-14H2,1-2H3,(H2,21,22,25) |
| InChIKey | KNMXSNGVOCAZNT-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.52 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |