C18H29N3O4 — CID 119224010
2-[3-(1-adamantylcarbamoylamino)propanoylamino]butanoic acid (PubChem CID 119224010) has the molecular formula C18H29N3O4 and a molecular weight of 351.45 g/mol. Its IUPAC name is 2-[3-(1-adamantylcarbamoylamino)propanoylamino]butanoic acid.
| Compound Name | 2-[3-(1-adamantylcarbamoylamino)propanoylamino]butanoic acid |
|---|---|
| PubChem CID | 119224010 |
| Molecular Formula | C18H29N3O4 |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.22 |
| IUPAC Name | 2-[3-(1-adamantylcarbamoylamino)propanoylamino]butanoic acid |
| SMILES | CCC(NC(=O)CCNC(=O)NC12CC3CC(CC(C3)C1)C2)C(=O)O |
| InChI | InChI=1S/C18H29N3O4/c1-2-14(16(23)24)20-15(22)3-4-19-17(25)21-18-8-11-5-12(9-18)7-13(6-11)10-18/h11-14H,2-10H2,1H3,(H,20,22)(H,23,24)(H2,19,21,25) |
| InChIKey | OFKQXZNKEOLJQE-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 107.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |