C20H33N3O4 — CID 119204442
4-[3-(1-adamantylcarbamoylamino)propanoylamino]-4-methylpentanoic acid (PubChem CID 119204442) has the molecular formula C20H33N3O4 and a molecular weight of 379.50 g/mol. Its IUPAC name is 4-[3-(1-adamantylcarbamoylamino)propanoylamino]-4-methylpentanoic acid.
| Compound Name | 4-[3-(1-adamantylcarbamoylamino)propanoylamino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 119204442 |
| Molecular Formula | C20H33N3O4 |
| Molecular Weight | 379.50 g/mol |
| Exact Mass | 379.25 |
| IUPAC Name | 4-[3-(1-adamantylcarbamoylamino)propanoylamino]-4-methylpentanoic acid |
| SMILES | CC(C)(CCC(=O)O)NC(=O)CCNC(=O)NC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C20H33N3O4/c1-19(2,5-3-17(25)26)22-16(24)4-6-21-18(27)23-20-10-13-7-14(11-20)9-15(8-13)12-20/h13-15H,3-12H2,1-2H3,(H,22,24)(H,25,26)(H2,21,23,27) |
| InChIKey | ZEVQVFQIFFEFKW-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 107.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.50 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |