C21H32N4O2 — CID 30288555
N-[2-[3-(3,5-dimethylpyrazol-1-yl)propylamino]-2-oxoethyl]adamantane-1-carboxamide (PubChem CID 30288555) has the molecular formula C21H32N4O2 and a molecular weight of 372.51 g/mol. Its IUPAC name is N-[2-[3-(3,5-dimethylpyrazol-1-yl)propylamino]-2-oxoethyl]adamantane-1-carboxamide.
| Compound Name | N-[2-[3-(3,5-dimethylpyrazol-1-yl)propylamino]-2-oxoethyl]adamantane-1-carboxamide |
|---|---|
| PubChem CID | 30288555 |
| Molecular Formula | C21H32N4O2 |
| Molecular Weight | 372.51 g/mol |
| Exact Mass | 372.25 |
| IUPAC Name | N-[2-[3-(3,5-dimethylpyrazol-1-yl)propylamino]-2-oxoethyl]adamantane-1-carboxamide |
| SMILES | Cc1cc(C)n(CCCNC(=O)CNC(=O)C23CC4CC(CC(C4)C2)C3)n1 |
| InChI | InChI=1S/C21H32N4O2/c1-14-6-15(2)25(24-14)5-3-4-22-19(26)13-23-20(27)21-10-16-7-17(11-21)9-18(8-16)12-21/h6,16-18H,3-5,7-13H2,1-2H3,(H,22,26)(H,23,27) |
| InChIKey | LCRLXNMIBPQCDO-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.51 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|